C32H40N2O3 — CID 142136239
5-(butylamino)-3-(4-tert-butylphenyl)-1-methylindole-2-carboxylic acid;1-methoxy-3-methylbenzene (PubChem CID 142136239) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 5-(butylamino)-3-(4-tert-butylphenyl)-1-methylindole-2-carboxylic acid;1-methoxy-3-methylbenzene.
| Compound Name | 5-(butylamino)-3-(4-tert-butylphenyl)-1-methylindole-2-carboxylic acid;1-methoxy-3-methylbenzene |
|---|---|
| PubChem CID | 142136239 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 5-(butylamino)-3-(4-tert-butylphenyl)-1-methylindole-2-carboxylic acid;1-methoxy-3-methylbenzene |
| SMILES | CCCCNc1ccc2c(c1)c(-c1ccc(C(C)(C)C)cc1)c(C(=O)O)n2C.COc1cccc(C)c1 |
| InChI | InChI=1S/C24H30N2O2.C8H10O/c1-6-7-14-25-18-12-13-20-19(15-18)21(22(23(27)28)26(20)5)16-8-10-17(11-9-16)24(2,3)4;1-7-4-3-5-8(6-7)9-2/h8-13,15,25H,6-7,14H2,1-5H3,(H,27,28);3-6H,1-2H3 |
| InChIKey | MMDNICYYCYHMBH-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|