About N-butyl-3-methylaniline;phenol
N-butyl-3-methylaniline;phenol (PubChem CID 18006904) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is N-butyl-3-methylaniline;phenol.
Molecular Properties
| Compound Name | N-butyl-3-methylaniline;phenol |
| PubChem CID | 18006904 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | N-butyl-3-methylaniline;phenol |
| SMILES | CCCCNc1cccc(C)c1.Oc1ccccc1 |
| InChI | InChI=1S/C11H17N.C6H6O/c1-3-4-8-12-11-7-5-6-10(2)9-11;7-6-4-2-1-3-5-6/h5-7,9,12H,3-4,8H2,1-2H3;1-5,7H |
| InChIKey | QPXWYJAHUIMYSC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3-methylaniline;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3-methylaniline;phenol?
The IUPAC name of N-butyl-3-methylaniline;phenol (CID 18006904) is N-butyl-3-methylaniline;phenol.
What is the SMILES notation for N-butyl-3-methylaniline;phenol?
The canonical SMILES for N-butyl-3-methylaniline;phenol is CCCCNc1cccc(C)c1.Oc1ccccc1.
What is the InChIKey of N-butyl-3-methylaniline;phenol?
The InChIKey is QPXWYJAHUIMYSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.C6H6O/c1-3-4-8-12-11-7-5-6-10(2)9-11;7-6-4-2-1-3-5-6/h5-7,9,12H,3-4,8H2,1-2H3;1-5,7H.
What are the key properties of N-butyl-3-methylaniline;phenol?
N-butyl-3-methylaniline;phenol has a molecular weight of 257.38 g/mol, XLogP of 4.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3-methylaniline;phenol is sourced from PubChem (CID 18006904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).