C27H27NO3 — CID 142136286
[3-[4-(cyclopropylmethoxy)phenyl]-1-[(3-methoxyphenyl)methyl]indol-2-yl]methanol (PubChem CID 142136286) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is [3-[4-(cyclopropylmethoxy)phenyl]-1-[(3-methoxyphenyl)methyl]indol-2-yl]methanol.
| Compound Name | [3-[4-(cyclopropylmethoxy)phenyl]-1-[(3-methoxyphenyl)methyl]indol-2-yl]methanol |
|---|---|
| PubChem CID | 142136286 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [3-[4-(cyclopropylmethoxy)phenyl]-1-[(3-methoxyphenyl)methyl]indol-2-yl]methanol |
| SMILES | COc1cccc(Cn2c(CO)c(-c3ccc(OCC4CC4)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C27H27NO3/c1-30-23-6-4-5-20(15-23)16-28-25-8-3-2-7-24(25)27(26(28)17-29)21-11-13-22(14-12-21)31-18-19-9-10-19/h2-8,11-15,19,29H,9-10,16-18H2,1H3 |
| InChIKey | ABXSNTVMFOFGOF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |