C28H28N2O4 — CID 142136250
N-[3-[1-[[3-(cyclopropylmethoxy)phenyl]methyl]-2-(dihydroxymethyl)indol-3-yl]phenyl]acetamide (PubChem CID 142136250) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[3-[1-[[3-(cyclopropylmethoxy)phenyl]methyl]-2-(dihydroxymethyl)indol-3-yl]phenyl]acetamide.
| Compound Name | N-[3-[1-[[3-(cyclopropylmethoxy)phenyl]methyl]-2-(dihydroxymethyl)indol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 142136250 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[3-[1-[[3-(cyclopropylmethoxy)phenyl]methyl]-2-(dihydroxymethyl)indol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2c(C(O)O)n(Cc3cccc(OCC4CC4)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C28H28N2O4/c1-18(31)29-22-8-5-7-21(15-22)26-24-10-2-3-11-25(24)30(27(26)28(32)33)16-20-6-4-9-23(14-20)34-17-19-12-13-19/h2-11,14-15,19,28,32-33H,12-13,16-17H2,1H3,(H,29,31) |
| InChIKey | XWLYWZUQZKFHST-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|