C27H26N2O4 — CID 142136236
3-[3-(butanoylamino)phenyl]-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid (PubChem CID 142136236) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[3-(butanoylamino)phenyl]-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[3-(butanoylamino)phenyl]-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 142136236 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[3-(butanoylamino)phenyl]-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid |
| SMILES | CCCC(=O)Nc1cccc(-c2c(C(=O)O)n(Cc3cccc(OC)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-3-8-24(30)28-20-11-7-10-19(16-20)25-22-13-4-5-14-23(22)29(26(25)27(31)32)17-18-9-6-12-21(15-18)33-2/h4-7,9-16H,3,8,17H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | KRWCUILRDMZGFE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |