C27H29NO4S — CID 142138089
(2S,3R)-3-[(2E,4Z)-1-hydroxyhepta-2,4-dien-6-yn-3-yl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-6-ol (PubChem CID 142138089) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is (2S,3R)-3-[(2E,4Z)-1-hydroxyhepta-2,4-dien-6-yn-3-yl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-6-ol.
| Compound Name | (2S,3R)-3-[(2E,4Z)-1-hydroxyhepta-2,4-dien-6-yn-3-yl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-6-ol |
|---|---|
| PubChem CID | 142138089 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S,3R)-3-[(2E,4Z)-1-hydroxyhepta-2,4-dien-6-yn-3-yl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-6-ol |
| SMILES | C#C/C=C\C(=C/CO)[C@H]1Sc2cc(O)ccc2O[C@H]1c1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C27H29NO4S/c1-2-3-6-21(13-17-29)27-26(32-24-12-9-22(30)19-25(24)33-27)20-7-10-23(11-8-20)31-18-16-28-14-4-5-15-28/h1,3,6-13,19,26-27,29-30H,4-5,14-18H2/b6-3-,21-13+/t26-,27+/m0/s1 |
| InChIKey | LUFJUCMXJDUHFU-BWQYWNDRSA-N |
| XLogP | 4.57 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|