C8H15NOS — CID 142141198
S-(1,5-dimethylpyrrolidin-3-yl) ethanethioate (PubChem CID 142141198) has the molecular formula C8H15NOS and a molecular weight of 173.28 g/mol. Its IUPAC name is S-(1,5-dimethylpyrrolidin-3-yl) ethanethioate.
| Compound Name | S-(1,5-dimethylpyrrolidin-3-yl) ethanethioate |
|---|---|
| PubChem CID | 142141198 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | S-(1,5-dimethylpyrrolidin-3-yl) ethanethioate |
| SMILES | CC(=O)SC1CC(C)N(C)C1 |
| InChI | InChI=1S/C8H15NOS/c1-6-4-8(5-9(6)3)11-7(2)10/h6,8H,4-5H2,1-3H3 |
| InChIKey | LXKJDIQMDSZQSJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|