C29H35N3O2 — CID 142142230
N-[amino(phenyl)methyl]-2-[3-[[1-(3-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexane-1-carboxamide (PubChem CID 142142230) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[amino(phenyl)methyl]-2-[3-[[1-(3-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexane-1-carboxamide.
| Compound Name | N-[amino(phenyl)methyl]-2-[3-[[1-(3-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142142230 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-[amino(phenyl)methyl]-2-[3-[[1-(3-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexane-1-carboxamide |
| SMILES | CC(NCc1cccc(C2CCCCC2C(=O)NC(N)c2ccccc2)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C29H35N3O2/c1-20(23-12-8-14-25(33)18-23)31-19-21-9-7-13-24(17-21)26-15-5-6-16-27(26)29(34)32-28(30)22-10-3-2-4-11-22/h2-4,7-14,17-18,20,26-28,31,33H,5-6,15-16,19,30H2,1H3,(H,32,34) |
| InChIKey | UIICTAGKRMUXNH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|