C27H47N5O — CID 142142776
ethane;(1Z,4Z)-8-imidazol-1-yl-N,N,2-trimethylocta-1,4-dien-1-amine;4-[(2-methyl-3,4-dihydropyridin-6-yl)methyl]morpholine (PubChem CID 142142776) has the molecular formula C27H47N5O and a molecular weight of 457.71 g/mol. Its IUPAC name is ethane;(1Z,4Z)-8-imidazol-1-yl-N,N,2-trimethylocta-1,4-dien-1-amine;4-[(2-methyl-3,4-dihydropyridin-6-yl)methyl]morpholine.
| Compound Name | ethane;(1Z,4Z)-8-imidazol-1-yl-N,N,2-trimethylocta-1,4-dien-1-amine;4-[(2-methyl-3,4-dihydropyridin-6-yl)methyl]morpholine |
|---|---|
| PubChem CID | 142142776 |
| Molecular Formula | C27H47N5O |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 457.38 |
| IUPAC Name | ethane;(1Z,4Z)-8-imidazol-1-yl-N,N,2-trimethylocta-1,4-dien-1-amine;4-[(2-methyl-3,4-dihydropyridin-6-yl)methyl]morpholine |
| SMILES | C/C(=C/N(C)C)C/C=C\CCCn1ccnc1.CC.CC1=NC(CN2CCOCC2)=CCC1 |
| InChI | InChI=1S/C14H23N3.C11H18N2O.C2H6/c1-14(12-16(2)3)8-6-4-5-7-10-17-11-9-15-13-17;1-10-3-2-4-11(12-10)9-13-5-7-14-8-6-13;1-2/h4,6,9,11-13H,5,7-8,10H2,1-3H3;4H,2-3,5-9H2,1H3;1-2H3/b6-4-,14-12-;; |
| InChIKey | PKWCUIRVSFRFJJ-PPRKHVGZSA-N |
| XLogP | 5.56 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|