C26H29N3O2 — CID 142144640
3-[2-[[[(3R)-3-phenylbutanoyl]amino]methyl]phenyl]-N-propylpyridine-2-carboxamide (PubChem CID 142144640) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[2-[[[(3R)-3-phenylbutanoyl]amino]methyl]phenyl]-N-propylpyridine-2-carboxamide.
| Compound Name | 3-[2-[[[(3R)-3-phenylbutanoyl]amino]methyl]phenyl]-N-propylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 142144640 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[2-[[[(3R)-3-phenylbutanoyl]amino]methyl]phenyl]-N-propylpyridine-2-carboxamide |
| SMILES | CCCNC(=O)c1ncccc1-c1ccccc1CNC(=O)C[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O2/c1-3-15-28-26(31)25-23(14-9-16-27-25)22-13-8-7-12-21(22)18-29-24(30)17-19(2)20-10-5-4-6-11-20/h4-14,16,19H,3,15,17-18H2,1-2H3,(H,28,31)(H,29,30)/t19-/m1/s1 |
| InChIKey | SKKADBVQFYQHNN-LJQANCHMSA-N |
| XLogP | 4.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |