C19H22N3O3- — CID 22667751
N-[[2-[2-(3-methylbutylcarbamoyl)-3-pyridinyl]phenyl]methyl]carbamate (PubChem CID 22667751) has the molecular formula C19H22N3O3- and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[[2-[2-(3-methylbutylcarbamoyl)-3-pyridinyl]phenyl]methyl]carbamate.
| Compound Name | N-[[2-[2-(3-methylbutylcarbamoyl)-3-pyridinyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22667751 |
| Molecular Formula | C19H22N3O3- |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[[2-[2-(3-methylbutylcarbamoyl)-3-pyridinyl]phenyl]methyl]carbamate |
| SMILES | CC(C)CCNC(=O)c1ncccc1-c1ccccc1CNC(=O)[O-] |
| InChI | InChI=1S/C19H23N3O3/c1-13(2)9-11-21-18(23)17-16(8-5-10-20-17)15-7-4-3-6-14(15)12-22-19(24)25/h3-8,10,13,22H,9,11-12H2,1-2H3,(H,21,23)(H,24,25)/p-1 |
| InChIKey | QXYRUQHLWXMTPV-UHFFFAOYSA-M |
| XLogP | 1.96 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |