C22H30N2O4 — CID 10293533
tert-butyl N-[[2-[3-(3-methylbutylcarbamoyl)furan-2-yl]phenyl]methyl]carbamate (PubChem CID 10293533) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl N-[[2-[3-(3-methylbutylcarbamoyl)furan-2-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[3-(3-methylbutylcarbamoyl)furan-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 10293533 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl N-[[2-[3-(3-methylbutylcarbamoyl)furan-2-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)CCNC(=O)c1ccoc1-c1ccccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O4/c1-15(2)10-12-23-20(25)18-11-13-27-19(18)17-9-7-6-8-16(17)14-24-21(26)28-22(3,4)5/h6-9,11,13,15H,10,12,14H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | DSTJTVHNLYVVEJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |