C28H25ClN2O3 — CID 142147013
2-[7-chloro-2-oxo-4-phenyl-6-[(4-phenylpiperazin-1-yl)methyl]chromen-3-yl]acetaldehyde (PubChem CID 142147013) has the molecular formula C28H25ClN2O3 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-[7-chloro-2-oxo-4-phenyl-6-[(4-phenylpiperazin-1-yl)methyl]chromen-3-yl]acetaldehyde.
| Compound Name | 2-[7-chloro-2-oxo-4-phenyl-6-[(4-phenylpiperazin-1-yl)methyl]chromen-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 142147013 |
| Molecular Formula | C28H25ClN2O3 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-[7-chloro-2-oxo-4-phenyl-6-[(4-phenylpiperazin-1-yl)methyl]chromen-3-yl]acetaldehyde |
| SMILES | O=CCc1c(-c2ccccc2)c2cc(CN3CCN(c4ccccc4)CC3)c(Cl)cc2oc1=O |
| InChI | InChI=1S/C28H25ClN2O3/c29-25-18-26-24(27(20-7-3-1-4-8-20)23(11-16-32)28(33)34-26)17-21(25)19-30-12-14-31(15-13-30)22-9-5-2-6-10-22/h1-10,16-18H,11-15,19H2 |
| InChIKey | CWIAAFSOSABCDD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|