C28H27ClN2O5 — CID 22267209
2-[7-chloro-6-[(dimethylamino)methyl]-2-oxo-4-phenylchromen-3-yl]-N-(2,6-dimethoxyphenyl)acetamide (PubChem CID 22267209) has the molecular formula C28H27ClN2O5 and a molecular weight of 506.99 g/mol. Its IUPAC name is 2-[7-chloro-6-[(dimethylamino)methyl]-2-oxo-4-phenylchromen-3-yl]-N-(2,6-dimethoxyphenyl)acetamide.
| Compound Name | 2-[7-chloro-6-[(dimethylamino)methyl]-2-oxo-4-phenylchromen-3-yl]-N-(2,6-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22267209 |
| Molecular Formula | C28H27ClN2O5 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 2-[7-chloro-6-[(dimethylamino)methyl]-2-oxo-4-phenylchromen-3-yl]-N-(2,6-dimethoxyphenyl)acetamide |
| SMILES | COc1cccc(OC)c1NC(=O)Cc1c(-c2ccccc2)c2cc(CN(C)C)c(Cl)cc2oc1=O |
| InChI | InChI=1S/C28H27ClN2O5/c1-31(2)16-18-13-19-24(15-21(18)29)36-28(33)20(26(19)17-9-6-5-7-10-17)14-25(32)30-27-22(34-3)11-8-12-23(27)35-4/h5-13,15H,14,16H2,1-4H3,(H,30,32) |
| InChIKey | PDVLHYUHDSAJSL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|