C21H17Br2ClO4 — CID 174475900
ethyl 2-[6-(2-bromoethyl)-4-(3-bromophenyl)-7-chloro-2-oxochromen-3-yl]acetate (PubChem CID 174475900) has the molecular formula C21H17Br2ClO4 and a molecular weight of 528.62 g/mol. Its IUPAC name is ethyl 2-[6-(2-bromoethyl)-4-(3-bromophenyl)-7-chloro-2-oxochromen-3-yl]acetate.
| Compound Name | ethyl 2-[6-(2-bromoethyl)-4-(3-bromophenyl)-7-chloro-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 174475900 |
| Molecular Formula | C21H17Br2ClO4 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 525.92 |
| IUPAC Name | ethyl 2-[6-(2-bromoethyl)-4-(3-bromophenyl)-7-chloro-2-oxochromen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(-c2cccc(Br)c2)c2cc(CCBr)c(Cl)cc2oc1=O |
| InChI | InChI=1S/C21H17Br2ClO4/c1-2-27-19(25)10-16-20(13-4-3-5-14(23)8-13)15-9-12(6-7-22)17(24)11-18(15)28-21(16)26/h3-5,8-9,11H,2,6-7,10H2,1H3 |
| InChIKey | GHDFOJDGDSJYLA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|