C20H16BrClO4 — CID 54752976
ethyl 2-[4-(3-bromophenyl)-7-chloro-6-methyl-2-oxochromen-3-yl]acetate (PubChem CID 54752976) has the molecular formula C20H16BrClO4 and a molecular weight of 435.70 g/mol. Its IUPAC name is ethyl 2-[4-(3-bromophenyl)-7-chloro-6-methyl-2-oxochromen-3-yl]acetate.
| Compound Name | ethyl 2-[4-(3-bromophenyl)-7-chloro-6-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 54752976 |
| Molecular Formula | C20H16BrClO4 |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | ethyl 2-[4-(3-bromophenyl)-7-chloro-6-methyl-2-oxochromen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(-c2cccc(Br)c2)c2cc(C)c(Cl)cc2oc1=O |
| InChI | InChI=1S/C20H16BrClO4/c1-3-25-18(23)9-15-19(12-5-4-6-13(21)8-12)14-7-11(2)16(22)10-17(14)26-20(15)24/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | QMUFQPJLDDBYSW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|