C25H15Cl3F3NO3 — CID 10187202
2-[6-chloro-4-(3-chlorophenyl)-7-methyl-2-oxochromen-3-yl]-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 10187202) has the molecular formula C25H15Cl3F3NO3 and a molecular weight of 540.75 g/mol. Its IUPAC name is 2-[6-chloro-4-(3-chlorophenyl)-7-methyl-2-oxochromen-3-yl]-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[6-chloro-4-(3-chlorophenyl)-7-methyl-2-oxochromen-3-yl]-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 10187202 |
| Molecular Formula | C25H15Cl3F3NO3 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | 2-[6-chloro-4-(3-chlorophenyl)-7-methyl-2-oxochromen-3-yl]-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc2oc(=O)c(CC(=O)Nc3ccc(Cl)cc3C(F)(F)F)c(-c3cccc(Cl)c3)c2cc1Cl |
| InChI | InChI=1S/C25H15Cl3F3NO3/c1-12-7-21-16(10-19(12)28)23(13-3-2-4-14(26)8-13)17(24(34)35-21)11-22(33)32-20-6-5-15(27)9-18(20)25(29,30)31/h2-10H,11H2,1H3,(H,32,33) |
| InChIKey | AYBCBJGYKNMJJF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|