C32H29ClF4N2O8 — CID 173118504
2-[bis(hydroxymethyl)amino]ethanol;3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoic acid (PubChem CID 173118504) has the molecular formula C32H29ClF4N2O8 and a molecular weight of 681.03 g/mol. Its IUPAC name is 2-[bis(hydroxymethyl)amino]ethanol;3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | 2-[bis(hydroxymethyl)amino]ethanol;3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 173118504 |
| Molecular Formula | C32H29ClF4N2O8 |
| Molecular Weight | 681.03 g/mol |
| Exact Mass | 680.15 |
| IUPAC Name | 2-[bis(hydroxymethyl)amino]ethanol;3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc2c(-c3cccc(C=CC(=O)O)c3)c(CC(=O)Nc3ccc(F)cc3C(F)(F)F)c(=O)oc2cc1Cl.OCCN(CO)CO |
| InChI | InChI=1S/C28H18ClF4NO5.C4H11NO3/c1-14-9-18-23(13-21(14)29)39-27(38)19(26(18)16-4-2-3-15(10-16)5-8-25(36)37)12-24(35)34-22-7-6-17(30)11-20(22)28(31,32)33;6-2-1-5(3-7)4-8/h2-11,13H,12H2,1H3,(H,34,35)(H,36,37);6-8H,1-4H2 |
| InChIKey | IKSZGQBEAPDXGG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 160.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.03 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|