C28H17Cl2F3NO5- — CID 22267203
(E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate (PubChem CID 22267203) has the molecular formula C28H17Cl2F3NO5- and a molecular weight of 575.35 g/mol. Its IUPAC name is (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 22267203 |
| Molecular Formula | C28H17Cl2F3NO5- |
| Molecular Weight | 575.35 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate |
| SMILES | Cc1cc2c(-c3cccc(/C=C/C(=O)[O-])c3)c(CC(=O)Nc3ccc(Cl)cc3C(F)(F)F)c(=O)oc2cc1Cl |
| InChI | InChI=1S/C28H18Cl2F3NO5/c1-14-9-18-23(13-21(14)30)39-27(38)19(26(18)16-4-2-3-15(10-16)5-8-25(36)37)12-24(35)34-22-7-6-17(29)11-20(22)28(31,32)33/h2-11,13H,12H2,1H3,(H,34,35)(H,36,37)/p-1/b8-5+ |
| InChIKey | ZBWCJODWCYEYBM-VMPITWQZSA-M |
| XLogP | 6.04 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.35 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|