C25H16ClF4NO4 — CID 87932138
2-(7-chloro-6-methyl-2-oxo-4-phenylchromen-3-yl)-N-[4-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]acetamide (PubChem CID 87932138) has the molecular formula C25H16ClF4NO4 and a molecular weight of 505.85 g/mol. Its IUPAC name is 2-(7-chloro-6-methyl-2-oxo-4-phenylchromen-3-yl)-N-[4-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(7-chloro-6-methyl-2-oxo-4-phenylchromen-3-yl)-N-[4-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87932138 |
| Molecular Formula | C25H16ClF4NO4 |
| Molecular Weight | 505.85 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-(7-chloro-6-methyl-2-oxo-4-phenylchromen-3-yl)-N-[4-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc2c(-c3ccccc3)c(CC(=O)Nc3c(O)cc(F)cc3C(F)(F)F)c(=O)oc2cc1Cl |
| InChI | InChI=1S/C25H16ClF4NO4/c1-12-7-15-20(11-18(12)26)35-24(34)16(22(15)13-5-3-2-4-6-13)10-21(33)31-23-17(25(28,29)30)8-14(27)9-19(23)32/h2-9,11,32H,10H2,1H3,(H,31,33) |
| InChIKey | YEECCSTTYFPMIJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.85 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|