C30H22Cl2F3NO5 — CID 10282279
ethyl (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate (PubChem CID 10282279) has the molecular formula C30H22Cl2F3NO5 and a molecular weight of 604.41 g/mol. Its IUPAC name is ethyl (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10282279 |
| Molecular Formula | C30H22Cl2F3NO5 |
| Molecular Weight | 604.41 g/mol |
| Exact Mass | 603.08 |
| IUPAC Name | ethyl (E)-3-[3-[7-chloro-3-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2c(CC(=O)Nc3ccc(Cl)cc3C(F)(F)F)c(=O)oc3cc(Cl)c(C)cc23)c1 |
| InChI | InChI=1S/C30H22Cl2F3NO5/c1-3-40-27(38)10-7-17-5-4-6-18(12-17)28-20-11-16(2)23(32)15-25(20)41-29(39)21(28)14-26(37)36-24-9-8-19(31)13-22(24)30(33,34)35/h4-13,15H,3,14H2,1-2H3,(H,36,37)/b10-7+ |
| InChIKey | KABJFAJHDDDLCD-JXMROGBWSA-N |
| XLogP | 7.85 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.41 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|