C28H19ClF4N2O5 — CID 76600686
amino 3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate (PubChem CID 76600686) has the molecular formula C28H19ClF4N2O5 and a molecular weight of 574.91 g/mol. Its IUPAC name is amino 3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate.
| Compound Name | amino 3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76600686 |
| Molecular Formula | C28H19ClF4N2O5 |
| Molecular Weight | 574.91 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | amino 3-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]prop-2-enoate |
| SMILES | Cc1cc2c(-c3cccc(C=CC(=O)ON)c3)c(CC(=O)Nc3ccc(F)cc3C(F)(F)F)c(=O)oc2cc1Cl |
| InChI | InChI=1S/C28H19ClF4N2O5/c1-14-9-18-23(13-21(14)29)39-27(38)19(26(18)16-4-2-3-15(10-16)5-8-25(37)40-34)12-24(36)35-22-7-6-17(30)11-20(22)28(31,32)33/h2-11,13H,12,34H2,1H3,(H,35,36) |
| InChIKey | DBLGAWBWZIEJCD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.91 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|