C31H26F4INO5 — CID 89338764
methyl 4-[3-[3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-7-(iodomethyl)-6-methyl-2-oxochromen-4-yl]phenyl]butanoate (PubChem CID 89338764) has the molecular formula C31H26F4INO5 and a molecular weight of 695.45 g/mol. Its IUPAC name is methyl 4-[3-[3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-7-(iodomethyl)-6-methyl-2-oxochromen-4-yl]phenyl]butanoate.
| Compound Name | methyl 4-[3-[3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-7-(iodomethyl)-6-methyl-2-oxochromen-4-yl]phenyl]butanoate |
|---|---|
| PubChem CID | 89338764 |
| Molecular Formula | C31H26F4INO5 |
| Molecular Weight | 695.45 g/mol |
| Exact Mass | 695.08 |
| IUPAC Name | methyl 4-[3-[3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-7-(iodomethyl)-6-methyl-2-oxochromen-4-yl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1cccc(-c2c(CC(=O)Nc3ccc(F)cc3C(F)(F)F)c(=O)oc3cc(CI)c(C)cc23)c1 |
| InChI | InChI=1S/C31H26F4INO5/c1-17-11-22-26(13-20(17)16-36)42-30(40)23(15-27(38)37-25-10-9-21(32)14-24(25)31(33,34)35)29(22)19-7-3-5-18(12-19)6-4-8-28(39)41-2/h3,5,7,9-14H,4,6,8,15-16H2,1-2H3,(H,37,38) |
| InChIKey | YDOWGKFMECKISA-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.45 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|