C28H21F3N2O3 — CID 142108478
2-[6-(cyanomethyl)-7-methyl-2-oxo-4-phenylchromen-3-yl]-N-[4-methyl-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 142108478) has the molecular formula C28H21F3N2O3 and a molecular weight of 490.48 g/mol. Its IUPAC name is 2-[6-(cyanomethyl)-7-methyl-2-oxo-4-phenylchromen-3-yl]-N-[4-methyl-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[6-(cyanomethyl)-7-methyl-2-oxo-4-phenylchromen-3-yl]-N-[4-methyl-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 142108478 |
| Molecular Formula | C28H21F3N2O3 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-[6-(cyanomethyl)-7-methyl-2-oxo-4-phenylchromen-3-yl]-N-[4-methyl-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2c(-c3ccccc3)c3cc(CC#N)c(C)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H21F3N2O3/c1-16-8-9-23(22(12-16)28(29,30)31)33-25(34)15-21-26(18-6-4-3-5-7-18)20-14-19(10-11-32)17(2)13-24(20)36-27(21)35/h3-9,12-14H,10,15H2,1-2H3,(H,33,34) |
| InChIKey | OVGUWHLORPGREE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|