C19H12ClF4NO3 — CID 141125659
2-(4-chloro-6-methyl-2-oxochromen-3-yl)-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 141125659) has the molecular formula C19H12ClF4NO3 and a molecular weight of 413.75 g/mol. Its IUPAC name is 2-(4-chloro-6-methyl-2-oxochromen-3-yl)-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-chloro-6-methyl-2-oxochromen-3-yl)-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 141125659 |
| Molecular Formula | C19H12ClF4NO3 |
| Molecular Weight | 413.75 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-(4-chloro-6-methyl-2-oxochromen-3-yl)-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc2oc(=O)c(CC(=O)Nc3ccc(F)cc3C(F)(F)F)c(Cl)c2c1 |
| InChI | InChI=1S/C19H12ClF4NO3/c1-9-2-5-15-11(6-9)17(20)12(18(27)28-15)8-16(26)25-14-4-3-10(21)7-13(14)19(22,23)24/h2-7H,8H2,1H3,(H,25,26) |
| InChIKey | CYQHOKCZLMMZGD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.75 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|