C24H17F2NO3 — CID 21463165
N-(2,4-difluorophenyl)-2-(6-methyl-2-oxo-4-phenylchromen-3-yl)acetamide (PubChem CID 21463165) has the molecular formula C24H17F2NO3 and a molecular weight of 405.40 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(6-methyl-2-oxo-4-phenylchromen-3-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(6-methyl-2-oxo-4-phenylchromen-3-yl)acetamide |
|---|---|
| PubChem CID | 21463165 |
| Molecular Formula | C24H17F2NO3 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(6-methyl-2-oxo-4-phenylchromen-3-yl)acetamide |
| SMILES | Cc1ccc2oc(=O)c(CC(=O)Nc3ccc(F)cc3F)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H17F2NO3/c1-14-7-10-21-17(11-14)23(15-5-3-2-4-6-15)18(24(29)30-21)13-22(28)27-20-9-8-16(25)12-19(20)26/h2-12H,13H2,1H3,(H,27,28) |
| InChIKey | SGZFFFORIPEDLC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|