C25H15Cl2F4NO3 — CID 22267268
2-[7-chloro-4-(3-chlorophenyl)-6-methyl-2-oxochromen-3-yl]-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 22267268) has the molecular formula C25H15Cl2F4NO3 and a molecular weight of 524.30 g/mol. Its IUPAC name is 2-[7-chloro-4-(3-chlorophenyl)-6-methyl-2-oxochromen-3-yl]-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[7-chloro-4-(3-chlorophenyl)-6-methyl-2-oxochromen-3-yl]-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 22267268 |
| Molecular Formula | C25H15Cl2F4NO3 |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | 2-[7-chloro-4-(3-chlorophenyl)-6-methyl-2-oxochromen-3-yl]-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc2c(-c3cccc(Cl)c3)c(CC(=O)Nc3ccc(F)cc3C(F)(F)F)c(=O)oc2cc1Cl |
| InChI | InChI=1S/C25H15Cl2F4NO3/c1-12-7-16-21(11-19(12)27)35-24(34)17(23(16)13-3-2-4-14(26)8-13)10-22(33)32-20-6-5-15(28)9-18(20)25(29,30)31/h2-9,11H,10H2,1H3,(H,32,33) |
| InChIKey | CQUQJVXJXUMUBG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|