C30H20ClF4NO5 — CID 23031782
(2E,4E)-5-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]penta-2,4-dienoic acid (PubChem CID 23031782) has the molecular formula C30H20ClF4NO5 and a molecular weight of 585.94 g/mol. Its IUPAC name is (2E,4E)-5-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 23031782 |
| Molecular Formula | C30H20ClF4NO5 |
| Molecular Weight | 585.94 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | (2E,4E)-5-[3-[7-chloro-3-[2-[4-fluoro-2-(trifluoromethyl)anilino]-2-oxoethyl]-6-methyl-2-oxochromen-4-yl]phenyl]penta-2,4-dienoic acid |
| SMILES | Cc1cc2c(-c3cccc(/C=C/C=C/C(=O)O)c3)c(CC(=O)Nc3ccc(F)cc3C(F)(F)F)c(=O)oc2cc1Cl |
| InChI | InChI=1S/C30H20ClF4NO5/c1-16-11-20-25(15-23(16)31)41-29(40)21(14-26(37)36-24-10-9-19(32)13-22(24)30(33,34)35)28(20)18-7-4-6-17(12-18)5-2-3-8-27(38)39/h2-13,15H,14H2,1H3,(H,36,37)(H,38,39)/b5-2+,8-3+ |
| InChIKey | UHJSBGCHCOCJPX-QKVOYMTASA-N |
| XLogP | 7.41 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.94 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|