C23H17F2N3O — CID 10045848
1-(2,4-difluorophenyl)-3-(6-methyl-4-phenylquinolin-3-yl)urea (PubChem CID 10045848) has the molecular formula C23H17F2N3O and a molecular weight of 389.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(6-methyl-4-phenylquinolin-3-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(6-methyl-4-phenylquinolin-3-yl)urea |
|---|---|
| PubChem CID | 10045848 |
| Molecular Formula | C23H17F2N3O |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(6-methyl-4-phenylquinolin-3-yl)urea |
| SMILES | Cc1ccc2ncc(NC(=O)Nc3ccc(F)cc3F)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H17F2N3O/c1-14-7-9-19-17(11-14)22(15-5-3-2-4-6-15)21(13-26-19)28-23(29)27-20-10-8-16(24)12-18(20)25/h2-13H,1H3,(H2,27,28,29) |
| InChIKey | KVGBLSFAMQTAAS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |