C22H13Cl2F2N3O — CID 67786930
1-[8-chloro-4-(2-chlorophenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea (PubChem CID 67786930) has the molecular formula C22H13Cl2F2N3O and a molecular weight of 444.27 g/mol. Its IUPAC name is 1-[8-chloro-4-(2-chlorophenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[8-chloro-4-(2-chlorophenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 67786930 |
| Molecular Formula | C22H13Cl2F2N3O |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-[8-chloro-4-(2-chlorophenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)Nc1cnc2c(Cl)cccc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C22H13Cl2F2N3O/c23-15-6-2-1-4-13(15)20-14-5-3-7-16(24)21(14)27-11-19(20)29-22(30)28-18-9-8-12(25)10-17(18)26/h1-11H,(H2,28,29,30) |
| InChIKey | UTFVJURADDRQIG-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |