C24H29F3N2O2S — CID 142147442
3-acetyl-1-cyclopropyl-7-[(3S,4R)-4-ethyl-3-methylpiperidin-1-yl]-2-ethylsulfanyl-5,6,8-trifluoroquinolin-4-one (PubChem CID 142147442) has the molecular formula C24H29F3N2O2S and a molecular weight of 466.57 g/mol. Its IUPAC name is 3-acetyl-1-cyclopropyl-7-[(3S,4R)-4-ethyl-3-methylpiperidin-1-yl]-2-ethylsulfanyl-5,6,8-trifluoroquinolin-4-one.
| Compound Name | 3-acetyl-1-cyclopropyl-7-[(3S,4R)-4-ethyl-3-methylpiperidin-1-yl]-2-ethylsulfanyl-5,6,8-trifluoroquinolin-4-one |
|---|---|
| PubChem CID | 142147442 |
| Molecular Formula | C24H29F3N2O2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3-acetyl-1-cyclopropyl-7-[(3S,4R)-4-ethyl-3-methylpiperidin-1-yl]-2-ethylsulfanyl-5,6,8-trifluoroquinolin-4-one |
| SMILES | CCSc1c(C(C)=O)c(=O)c2c(F)c(F)c(N3CC[C@@H](CC)[C@H](C)C3)c(F)c2n1C1CC1 |
| InChI | InChI=1S/C24H29F3N2O2S/c1-5-14-9-10-28(11-12(14)3)22-19(26)18(25)17-21(20(22)27)29(15-7-8-15)24(32-6-2)16(13(4)30)23(17)31/h12,14-15H,5-11H2,1-4H3/t12-,14-/m1/s1 |
| InChIKey | RXONNILAYROULJ-TZMCWYRMSA-N |
| XLogP | 5.94 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|