C20H21F3N4O3S — CID 91381405
7-[(3R,4R)-3-amino-4-(2-hydroxyethyl)piperidin-1-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 91381405) has the molecular formula C20H21F3N4O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 7-[(3R,4R)-3-amino-4-(2-hydroxyethyl)piperidin-1-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 7-[(3R,4R)-3-amino-4-(2-hydroxyethyl)piperidin-1-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 91381405 |
| Molecular Formula | C20H21F3N4O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 7-[(3R,4R)-3-amino-4-(2-hydroxyethyl)piperidin-1-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | N[C@H]1CN(c2c(F)c(F)c3c(=O)c4c(=O)[nH]sc4n(C4CC4)c3c2F)CC[C@@H]1CCO |
| InChI | InChI=1S/C20H21F3N4O3S/c21-13-11-16(27(9-1-2-9)20-12(18(11)29)19(30)25-31-20)15(23)17(14(13)22)26-5-3-8(4-6-28)10(24)7-26/h8-10,28H,1-7,24H2,(H,25,30)/t8-,10+/m1/s1 |
| InChIKey | QEDPXZYJHVEYFX-SCZZXKLOSA-N |
| XLogP | 2.19 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|