C21H22ClF3N4O2S — CID 20792071
7-[(8R)-7-amino-8-methyl-5-azaspiro[2.5]octan-2-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione;hydrochloride (PubChem CID 20792071) has the molecular formula C21H22ClF3N4O2S and a molecular weight of 486.95 g/mol. Its IUPAC name is 7-[(8R)-7-amino-8-methyl-5-azaspiro[2.5]octan-2-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione;hydrochloride.
| Compound Name | 7-[(8R)-7-amino-8-methyl-5-azaspiro[2.5]octan-2-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione;hydrochloride |
|---|---|
| PubChem CID | 20792071 |
| Molecular Formula | C21H22ClF3N4O2S |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 7-[(8R)-7-amino-8-methyl-5-azaspiro[2.5]octan-2-yl]-9-cyclopropyl-5,6,8-trifluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione;hydrochloride |
| SMILES | C[C@H]1C(N)CNCC12CC2c1c(F)c(F)c2c(=O)c3c(=O)[nH]sc3n(C3CC3)c2c1F.Cl |
| InChI | InChI=1S/C21H21F3N4O2S.ClH/c1-7-10(25)5-26-6-21(7)4-9(21)11-14(22)15(23)12-17(16(11)24)28(8-2-3-8)20-13(18(12)29)19(30)27-31-20;/h7-10,26H,2-6,25H2,1H3,(H,27,30);1H/t7-,9?,10?,21?;/m0./s1 |
| InChIKey | NVJAZHYTRRRZAZ-HEXYMDHXSA-N |
| XLogP | 3.12 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|