C24H26FNO5 — CID 142148700
2-[[1-[(2E,4E)-2-ethyl-5-fluorohexa-2,4-dienyl]-2-methyl-3-oxaldehydoyl-7,8-dihydro-6H-cyclopenta[g]indol-4-yl]oxy]acetic acid (PubChem CID 142148700) has the molecular formula C24H26FNO5 and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[[1-[(2E,4E)-2-ethyl-5-fluorohexa-2,4-dienyl]-2-methyl-3-oxaldehydoyl-7,8-dihydro-6H-cyclopenta[g]indol-4-yl]oxy]acetic acid.
| Compound Name | 2-[[1-[(2E,4E)-2-ethyl-5-fluorohexa-2,4-dienyl]-2-methyl-3-oxaldehydoyl-7,8-dihydro-6H-cyclopenta[g]indol-4-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 142148700 |
| Molecular Formula | C24H26FNO5 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[[1-[(2E,4E)-2-ethyl-5-fluorohexa-2,4-dienyl]-2-methyl-3-oxaldehydoyl-7,8-dihydro-6H-cyclopenta[g]indol-4-yl]oxy]acetic acid |
| SMILES | CC/C(=C\C=C(/C)F)Cn1c(C)c(C(=O)C=O)c2c(OCC(=O)O)cc3c(c21)CCC3 |
| InChI | InChI=1S/C24H26FNO5/c1-4-16(9-8-14(2)25)11-26-15(3)22(19(28)12-27)23-20(31-13-21(29)30)10-17-6-5-7-18(17)24(23)26/h8-10,12H,4-7,11,13H2,1-3H3,(H,29,30)/b14-8+,16-9+ |
| InChIKey | QQAPPRZJBRGLLH-JTHWEQIXSA-N |
| XLogP | 4.49 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|