C20H23BrN2O5 — CID 143459503
2-[7-bromo-1-[(2E)-2-ethylidenepentyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetic acid (PubChem CID 143459503) has the molecular formula C20H23BrN2O5 and a molecular weight of 451.32 g/mol. Its IUPAC name is 2-[7-bromo-1-[(2E)-2-ethylidenepentyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetic acid.
| Compound Name | 2-[7-bromo-1-[(2E)-2-ethylidenepentyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 143459503 |
| Molecular Formula | C20H23BrN2O5 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[7-bromo-1-[(2E)-2-ethylidenepentyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetic acid |
| SMILES | C/C=C(\CCC)Cn1c(C)c(C(=O)C(N)=O)c2c(OCC(=O)O)ccc(Br)c21 |
| InChI | InChI=1S/C20H23BrN2O5/c1-4-6-12(5-2)9-23-11(3)16(19(26)20(22)27)17-14(28-10-15(24)25)8-7-13(21)18(17)23/h5,7-8H,4,6,9-10H2,1-3H3,(H2,22,27)(H,24,25)/b12-5+ |
| InChIKey | UDAVEXSEYIHWEC-LFYBBSHMSA-N |
| XLogP | 3.59 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|