C19H25N3O3S2 — CID 142149094
1-methyl-3-[5-(3-methylphenyl)thiophen-2-yl]-1-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 142149094) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-methyl-3-[5-(3-methylphenyl)thiophen-2-yl]-1-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-methyl-3-[5-(3-methylphenyl)thiophen-2-yl]-1-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 142149094 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-methyl-3-[5-(3-methylphenyl)thiophen-2-yl]-1-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | Cc1cccc(-c2ccc(NC(=O)N(C)C3CCN(S(C)(=O)=O)CC3)s2)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-14-5-4-6-15(13-14)17-7-8-18(26-17)20-19(23)21(2)16-9-11-22(12-10-16)27(3,24)25/h4-8,13,16H,9-12H2,1-3H3,(H,20,23) |
| InChIKey | GKSVPDZOPQJREW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |