C20H20BrN5OS2 — CID 142149170
[3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]phenyl]-(1,4-diazepan-1-yl)methanone (PubChem CID 142149170) has the molecular formula C20H20BrN5OS2 and a molecular weight of 490.45 g/mol. Its IUPAC name is [3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]phenyl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]phenyl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 142149170 |
| Molecular Formula | C20H20BrN5OS2 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | [3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]sulfanyl]phenyl]-(1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1cccc(Sc2cnc(Nc3cccc(Br)n3)s2)c1)N1CCCNCC1 |
| InChI | InChI=1S/C20H20BrN5OS2/c21-16-6-2-7-17(24-16)25-20-23-13-18(29-20)28-15-5-1-4-14(12-15)19(27)26-10-3-8-22-9-11-26/h1-2,4-7,12-13,22H,3,8-11H2,(H,23,24,25) |
| InChIKey | BRNZQMPVQZUAPE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|