2,2-dimethylpropane;methanamine;molecular hydrogen

C6H19N — CID 142152372

IUPAC2,2-dimethylpropane;methanamine;molecular hydrogen
SMILESCC(C)(C)C.CN.[H][H]
InChIInChI=1S/C5H12.CH5N.H2/c1-5(2,3)4;1-2;/h1-4H3;2H2,1H3;1H
InChIKeyJOFJFHVGAMXCEE-UHFFFAOYSA-N
MW105.22 g/mol
LogP1.87
Rot. Bonds

About 2,2-dimethylpropane;methanamine;molecular hydrogen

2,2-dimethylpropane;methanamine;molecular hydrogen (PubChem CID 142152372) has the molecular formula C6H19N and a molecular weight of 105.22 g/mol. Its IUPAC name is 2,2-dimethylpropane;methanamine;molecular hydrogen.

Molecular Properties

Compound Name2,2-dimethylpropane;methanamine;molecular hydrogen
PubChem CID142152372
Molecular FormulaC6H19N
Molecular Weight105.22 g/mol
Exact Mass105.15
IUPAC Name2,2-dimethylpropane;methanamine;molecular hydrogen
SMILESCC(C)(C)C.CN.[H][H]
InChIInChI=1S/C5H12.CH5N.H2/c1-5(2,3)4;1-2;/h1-4H3;2H2,1H3;1H
InChIKeyJOFJFHVGAMXCEE-UHFFFAOYSA-N
XLogP1.87
TPSA26.02 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500105.22
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-dimethylpropane;methanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylpropane;methanamine;molecular hydrogen?
The IUPAC name of 2,2-dimethylpropane;methanamine;molecular hydrogen (CID 142152372) is 2,2-dimethylpropane;methanamine;molecular hydrogen.
What is the SMILES notation for 2,2-dimethylpropane;methanamine;molecular hydrogen?
The canonical SMILES for 2,2-dimethylpropane;methanamine;molecular hydrogen is CC(C)(C)C.CN.[H][H].
What is the InChIKey of 2,2-dimethylpropane;methanamine;molecular hydrogen?
The InChIKey is JOFJFHVGAMXCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.CH5N.H2/c1-5(2,3)4;1-2;/h1-4H3;2H2,1H3;1H.
What are the key properties of 2,2-dimethylpropane;methanamine;molecular hydrogen?
2,2-dimethylpropane;methanamine;molecular hydrogen has a molecular weight of 105.22 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;methanamine;molecular hydrogen is sourced from PubChem (CID 142152372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).