C9H23NO — CID 177024221
methanamine;molecular hydrogen;2,2,4-trimethylpentanal (PubChem CID 177024221) has the molecular formula C9H23NO and a molecular weight of 161.29 g/mol. Its IUPAC name is methanamine;molecular hydrogen;2,2,4-trimethylpentanal.
| Compound Name | methanamine;molecular hydrogen;2,2,4-trimethylpentanal |
|---|---|
| PubChem CID | 177024221 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | methanamine;molecular hydrogen;2,2,4-trimethylpentanal |
| SMILES | CC(C)CC(C)(C)C=O.CN.[H][H] |
| InChI | InChI=1S/C8H16O.CH5N.H2/c1-7(2)5-8(3,4)6-9;1-2;/h6-7H,5H2,1-4H3;2H2,1H3;1H |
| InChIKey | JCLRQBNIWGSTQK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|