C16H34O — CID 172777004
2,4,4-trimethylpentanal;2,2,4-trimethylpentane (PubChem CID 172777004) has the molecular formula C16H34O and a molecular weight of 242.45 g/mol. Its IUPAC name is 2,4,4-trimethylpentanal;2,2,4-trimethylpentane.
| Compound Name | 2,4,4-trimethylpentanal;2,2,4-trimethylpentane |
|---|---|
| PubChem CID | 172777004 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 2,4,4-trimethylpentanal;2,2,4-trimethylpentane |
| SMILES | CC(C)CC(C)(C)C.CC(C=O)CC(C)(C)C |
| InChI | InChI=1S/C8H16O.C8H18/c1-7(6-9)5-8(2,3)4;1-7(2)6-8(3,4)5/h6-7H,5H2,1-4H3;7H,6H2,1-5H3 |
| InChIKey | NSVCOVDNMAYWAM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|