C18H38N2O — CID 166885394
4-[[2,4-dimethyl-4-(2-methylpropylamino)pentan-2-yl]amino]-2,4-dimethylpentanal (PubChem CID 166885394) has the molecular formula C18H38N2O and a molecular weight of 298.52 g/mol. Its IUPAC name is 4-[[2,4-dimethyl-4-(2-methylpropylamino)pentan-2-yl]amino]-2,4-dimethylpentanal.
| Compound Name | 4-[[2,4-dimethyl-4-(2-methylpropylamino)pentan-2-yl]amino]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 166885394 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | 4-[[2,4-dimethyl-4-(2-methylpropylamino)pentan-2-yl]amino]-2,4-dimethylpentanal |
| SMILES | CC(C)CNC(C)(C)CC(C)(C)NC(C)(C)CC(C)C=O |
| InChI | InChI=1S/C18H38N2O/c1-14(2)11-19-17(6,7)13-18(8,9)20-16(4,5)10-15(3)12-21/h12,14-15,19-20H,10-11,13H2,1-9H3 |
| InChIKey | MZWMWXHGWREXOM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|