C12H23NO3 — CID 170852244
azane;furan-2,5-dione;2,2,4-trimethylpentane (PubChem CID 170852244) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is azane;furan-2,5-dione;2,2,4-trimethylpentane.
| Compound Name | azane;furan-2,5-dione;2,2,4-trimethylpentane |
|---|---|
| PubChem CID | 170852244 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | azane;furan-2,5-dione;2,2,4-trimethylpentane |
| SMILES | CC(C)CC(C)(C)C.N.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C8H18.C4H2O3.H3N/c1-7(2)6-8(3,4)5;5-3-1-2-4(6)7-3;/h7H,6H2,1-5H3;1-2H;1H3 |
| InChIKey | HNARZHMISXBOQJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|