About 2-aminoethanethiol;furan-2,5-dione
2-aminoethanethiol;furan-2,5-dione (PubChem CID 174187998) has the molecular formula C6H9NO3S
and a molecular weight of 175.21 g/mol. Its IUPAC name is 2-aminoethanethiol;furan-2,5-dione.
Molecular Properties
| Compound Name | 2-aminoethanethiol;furan-2,5-dione |
| PubChem CID | 174187998 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 2-aminoethanethiol;furan-2,5-dione |
| SMILES | NCCS.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.C2H7NS/c5-3-1-2-4(6)7-3;3-1-2-4/h1-2H;4H,1-3H2 |
| InChIKey | LUAZPSRTZLAPTF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanethiol;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanethiol;furan-2,5-dione?
The IUPAC name of 2-aminoethanethiol;furan-2,5-dione (CID 174187998) is 2-aminoethanethiol;furan-2,5-dione.
What is the SMILES notation for 2-aminoethanethiol;furan-2,5-dione?
The canonical SMILES for 2-aminoethanethiol;furan-2,5-dione is NCCS.O=C1C=CC(=O)O1.
What is the InChIKey of 2-aminoethanethiol;furan-2,5-dione?
The InChIKey is LUAZPSRTZLAPTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C2H7NS/c5-3-1-2-4(6)7-3;3-1-2-4/h1-2H;4H,1-3H2.
What are the key properties of 2-aminoethanethiol;furan-2,5-dione?
2-aminoethanethiol;furan-2,5-dione has a molecular weight of 175.21 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanethiol;furan-2,5-dione is sourced from PubChem (CID 174187998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).