C12H22O7 — CID 6452514
2,2-dimethylpropane-1,3-diol;furan-2,5-dione;propane-1,2-diol (PubChem CID 6452514) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;furan-2,5-dione;propane-1,2-diol.
| Compound Name | 2,2-dimethylpropane-1,3-diol;furan-2,5-dione;propane-1,2-diol |
|---|---|
| PubChem CID | 6452514 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2,2-dimethylpropane-1,3-diol;furan-2,5-dione;propane-1,2-diol |
| SMILES | CC(C)(CO)CO.CC(O)CO.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H12O2.C4H2O3.C3H8O2/c1-5(2,3-6)4-7;5-3-1-2-4(6)7-3;1-3(5)2-4/h6-7H,3-4H2,1-2H3;1-2H;3-5H,2H2,1H3 |
| InChIKey | UTICFIDXXVGEPY-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|