C20H21N3O4 — CID 142152503
methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate (PubChem CID 142152503) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate.
| Compound Name | methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate |
|---|---|
| PubChem CID | 142152503 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate |
| SMILES | COC(=O)N(OC)c1ccccc1COc1ccn(C2=CCC=CC=C2)n1 |
| InChI | InChI=1S/C20H21N3O4/c1-25-20(24)23(26-2)18-12-8-7-9-16(18)15-27-19-13-14-22(21-19)17-10-5-3-4-6-11-17/h3-5,7-14H,6,15H2,1-2H3 |
| InChIKey | CDOTVGKITFWGHN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|