C22H27N3O4 — CID 142152505
ethane;methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate (PubChem CID 142152505) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethane;methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate.
| Compound Name | ethane;methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate |
|---|---|
| PubChem CID | 142152505 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethane;methyl N-[2-[(1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)oxymethyl]phenyl]-N-methoxycarbamate |
| SMILES | CC.COC(=O)N(OC)c1ccccc1COc1ccn(C2=CCC=CC=C2)n1 |
| InChI | InChI=1S/C20H21N3O4.C2H6/c1-25-20(24)23(26-2)18-12-8-7-9-16(18)15-27-19-13-14-22(21-19)17-10-5-3-4-6-11-17;1-2/h3-5,7-14H,6,15H2,1-2H3;1-2H3 |
| InChIKey | NKTSJIHZJOAWBW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|