C32H42O6Si — CID 14215325
4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-ol (PubChem CID 14215325) has the molecular formula C32H42O6Si and a molecular weight of 550.77 g/mol. Its IUPAC name is 4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-ol.
| Compound Name | 4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 14215325 |
| Molecular Formula | C32H42O6Si |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-ol |
| SMILES | C[Si](C)(C)CCOC1OC(COCc2ccccc2)C(O)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C32H42O6Si/c1-39(2,3)20-19-35-32-31(37-23-27-17-11-6-12-18-27)30(36-22-26-15-9-5-10-16-26)29(33)28(38-32)24-34-21-25-13-7-4-8-14-25/h4-18,28-33H,19-24H2,1-3H3 |
| InChIKey | LQFPSBRSSRUOGE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|