acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde

C9H13NO3 — CID 142153263

IUPACacetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde
SMILESCC(=O)O.Cc1c[nH]c(C=O)c1C
InChIInChI=1S/C7H9NO.C2H4O2/c1-5-3-8-7(4-9)6(5)2;1-2(3)4/h3-4,8H,1-2H3;1H3,(H,3,4)
InChIKeyDCRYUSBFQQYJFS-UHFFFAOYSA-N
MW183.21 g/mol
LogP1.53
Rot. Bonds1

About acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde

acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde (PubChem CID 142153263) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde.

Molecular Properties

Compound Nameacetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde
PubChem CID142153263
Molecular FormulaC9H13NO3
Molecular Weight183.21 g/mol
Exact Mass183.09
IUPAC Nameacetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde
SMILESCC(=O)O.Cc1c[nH]c(C=O)c1C
InChIInChI=1S/C7H9NO.C2H4O2/c1-5-3-8-7(4-9)6(5)2;1-2(3)4/h3-4,8H,1-2H3;1H3,(H,3,4)
InChIKeyDCRYUSBFQQYJFS-UHFFFAOYSA-N
XLogP1.53
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.21
LogP ≤ 51.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde?
The IUPAC name of acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde (CID 142153263) is acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde.
What is the SMILES notation for acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde?
The canonical SMILES for acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde is CC(=O)O.Cc1c[nH]c(C=O)c1C.
What is the InChIKey of acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde?
The InChIKey is DCRYUSBFQQYJFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C2H4O2/c1-5-3-8-7(4-9)6(5)2;1-2(3)4/h3-4,8H,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde?
acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde has a molecular weight of 183.21 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3,4-dimethyl-1H-pyrrole-2-carbaldehyde is sourced from PubChem (CID 142153263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).