About cyclobutylmethyl ethanimidothioate
cyclobutylmethyl ethanimidothioate (PubChem CID 142153982) has the molecular formula C7H13NS
and a molecular weight of 143.26 g/mol. Its IUPAC name is cyclobutylmethyl ethanimidothioate.
Molecular Properties
| Compound Name | cyclobutylmethyl ethanimidothioate |
| PubChem CID | 142153982 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.26 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | cyclobutylmethyl ethanimidothioate |
| SMILES | [H]/N=C(\C)SCC1CCC1 |
| InChI | InChI=1S/C7H13NS/c1-6(8)9-5-7-3-2-4-7/h7-8H,2-5H2,1H3/b8-6+ |
| InChIKey | SPZWKELKEMZIQC-SOFGYWHQSA-N |
| XLogP | 2.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclobutylmethyl ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylmethyl ethanimidothioate?
The IUPAC name of cyclobutylmethyl ethanimidothioate (CID 142153982) is cyclobutylmethyl ethanimidothioate.
What is the SMILES notation for cyclobutylmethyl ethanimidothioate?
The canonical SMILES for cyclobutylmethyl ethanimidothioate is [H]/N=C(\C)SCC1CCC1.
What is the InChIKey of cyclobutylmethyl ethanimidothioate?
The InChIKey is SPZWKELKEMZIQC-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H13NS/c1-6(8)9-5-7-3-2-4-7/h7-8H,2-5H2,1H3/b8-6+.
What are the key properties of cyclobutylmethyl ethanimidothioate?
cyclobutylmethyl ethanimidothioate has a molecular weight of 143.26 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylmethyl ethanimidothioate is sourced from PubChem (CID 142153982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).