C18H36N4S2 — CID 170227665
2-[7-(2-carbamimidoylsulfanylethyl)cyclododecyl]ethyl carbamimidothioate (PubChem CID 170227665) has the molecular formula C18H36N4S2 and a molecular weight of 372.65 g/mol. Its IUPAC name is 2-[7-(2-carbamimidoylsulfanylethyl)cyclododecyl]ethyl carbamimidothioate.
| Compound Name | 2-[7-(2-carbamimidoylsulfanylethyl)cyclododecyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 170227665 |
| Molecular Formula | C18H36N4S2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-[7-(2-carbamimidoylsulfanylethyl)cyclododecyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCC1CCCCCC(CCS/C(N)=N/[H])CCCCC1 |
| InChI | InChI=1S/C18H36N4S2/c19-17(20)23-13-11-15-7-3-1-4-8-16(10-6-2-5-9-15)12-14-24-18(21)22/h15-16H,1-14H2,(H3,19,20)(H3,21,22) |
| InChIKey | UIHUUMOMEIRZIP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|